About 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide
4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide (PubChem CID 3675444) has the molecular formula C22H23FN4O
and a molecular weight of 378.45 g/mol. Its IUPAC name is 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide.
Molecular Properties
| Compound Name | 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide |
| PubChem CID | 3675444 |
| Molecular Formula | C22H23FN4O |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide |
| SMILES | O=C(NN=C1C2CN3CCN(C2)CC1(c1ccccc1)C3)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN4O/c23-19-8-6-16(7-9-19)21(28)25-24-20-17-12-26-10-11-27(13-17)15-22(20,14-26)18-4-2-1-3-5-18/h1-9,17H,10-15H2,(H,25,28) |
| InChIKey | JWJRAISBKPQENH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide?
The IUPAC name of 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide (CID 3675444) is 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide.
What is the SMILES notation for 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide?
The canonical SMILES for 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide is O=C(NN=C1C2CN3CCN(C2)CC1(c1ccccc1)C3)c1ccc(F)cc1.
What is the InChIKey of 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide?
The InChIKey is JWJRAISBKPQENH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23FN4O/c23-19-8-6-16(7-9-19)21(28)25-24-20-17-12-26-10-11-27(13-17)15-22(20,14-26)18-4-2-1-3-5-18/h1-9,17H,10-15H2,(H,25,28).
What are the key properties of 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide?
4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide has a molecular weight of 378.45 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-[(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]benzamide is sourced from PubChem (CID 3675444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).