About 2-(2-bromoethoxy)-1,4-dimethylbenzene
2-(2-bromoethoxy)-1,4-dimethylbenzene (PubChem CID 3676742) has the molecular formula C10H13BrO
and a molecular weight of 229.12 g/mol. Its IUPAC name is 2-(2-bromoethoxy)-1,4-dimethylbenzene.
Molecular Properties
| Compound Name | 2-(2-bromoethoxy)-1,4-dimethylbenzene |
| PubChem CID | 3676742 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 2-(2-bromoethoxy)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(OCCBr)c1 |
| InChI | InChI=1S/C10H13BrO/c1-8-3-4-9(2)10(7-8)12-6-5-11/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | JBISLHJJABQJNR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromoethoxy)-1,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromoethoxy)-1,4-dimethylbenzene?
The IUPAC name of 2-(2-bromoethoxy)-1,4-dimethylbenzene (CID 3676742) is 2-(2-bromoethoxy)-1,4-dimethylbenzene.
What is the SMILES notation for 2-(2-bromoethoxy)-1,4-dimethylbenzene?
The canonical SMILES for 2-(2-bromoethoxy)-1,4-dimethylbenzene is Cc1ccc(C)c(OCCBr)c1.
What is the InChIKey of 2-(2-bromoethoxy)-1,4-dimethylbenzene?
The InChIKey is JBISLHJJABQJNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrO/c1-8-3-4-9(2)10(7-8)12-6-5-11/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 2-(2-bromoethoxy)-1,4-dimethylbenzene?
2-(2-bromoethoxy)-1,4-dimethylbenzene has a molecular weight of 229.12 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromoethoxy)-1,4-dimethylbenzene is sourced from PubChem (CID 3676742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).