C7H5F7NO3- — CID 3676821
2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propanoate (PubChem CID 3676821) has the molecular formula C7H5F7NO3- and a molecular weight of 284.11 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propanoate.
| Compound Name | 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propanoate |
|---|---|
| PubChem CID | 3676821 |
| Molecular Formula | C7H5F7NO3- |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propanoate |
| SMILES | CC(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C7H6F7NO3/c1-2(3(16)17)15-4(18)5(8,9)6(10,11)7(12,13)14/h2H,1H3,(H,15,18)(H,16,17)/p-1 |
| InChIKey | ZPIAJABLAZAXBG-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|