C7H6F7NO3 — CID 3676822
2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propanoic acid (PubChem CID 3676822) has the molecular formula C7H6F7NO3 and a molecular weight of 285.12 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propanoic acid.
| Compound Name | 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propanoic acid |
|---|---|
| PubChem CID | 3676822 |
| Molecular Formula | C7H6F7NO3 |
| Molecular Weight | 285.12 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propanoic acid |
| SMILES | CC(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C7H6F7NO3/c1-2(3(16)17)15-4(18)5(8,9)6(10,11)7(12,13)14/h2H,1H3,(H,15,18)(H,16,17) |
| InChIKey | ZPIAJABLAZAXBG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.12 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|