C30H22N4OS — CID 3677252
6-[5-(1-benzothiophen-2-yl)-3-pyridinyl]-2-methyl-N-(4-phenoxyphenyl)pyrimidin-4-amine (PubChem CID 3677252) has the molecular formula C30H22N4OS and a molecular weight of 486.60 g/mol. Its IUPAC name is 6-[5-(1-benzothiophen-2-yl)-3-pyridinyl]-2-methyl-N-(4-phenoxyphenyl)pyrimidin-4-amine.
| Compound Name | 6-[5-(1-benzothiophen-2-yl)-3-pyridinyl]-2-methyl-N-(4-phenoxyphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3677252 |
| Molecular Formula | C30H22N4OS |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 6-[5-(1-benzothiophen-2-yl)-3-pyridinyl]-2-methyl-N-(4-phenoxyphenyl)pyrimidin-4-amine |
| SMILES | Cc1nc(Nc2ccc(Oc3ccccc3)cc2)cc(-c2cncc(-c3cc4ccccc4s3)c2)n1 |
| InChI | InChI=1S/C30H22N4OS/c1-20-32-27(22-15-23(19-31-18-22)29-16-21-7-5-6-10-28(21)36-29)17-30(33-20)34-24-11-13-26(14-12-24)35-25-8-3-2-4-9-25/h2-19H,1H3,(H,32,33,34) |
| InChIKey | ZLJAREVLXRFLQR-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |