About 1-octylbenzotriazole
1-octylbenzotriazole (PubChem CID 3678166) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-octylbenzotriazole.
Molecular Properties
| Compound Name | 1-octylbenzotriazole |
| PubChem CID | 3678166 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 1-octylbenzotriazole |
| SMILES | CCCCCCCCn1nnc2ccccc21 |
| InChI | InChI=1S/C14H21N3/c1-2-3-4-5-6-9-12-17-14-11-8-7-10-13(14)15-16-17/h7-8,10-11H,2-6,9,12H2,1H3 |
| InChIKey | DMJFSRDJSLYNCP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-octylbenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octylbenzotriazole?
The IUPAC name of 1-octylbenzotriazole (CID 3678166) is 1-octylbenzotriazole.
What is the SMILES notation for 1-octylbenzotriazole?
The canonical SMILES for 1-octylbenzotriazole is CCCCCCCCn1nnc2ccccc21.
What is the InChIKey of 1-octylbenzotriazole?
The InChIKey is DMJFSRDJSLYNCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3/c1-2-3-4-5-6-9-12-17-14-11-8-7-10-13(14)15-16-17/h7-8,10-11H,2-6,9,12H2,1H3.
What are the key properties of 1-octylbenzotriazole?
1-octylbenzotriazole has a molecular weight of 231.34 g/mol, XLogP of 3.79, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octylbenzotriazole is sourced from PubChem (CID 3678166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).