About benzhydryl 2-imidazol-1-ylacetate
benzhydryl 2-imidazol-1-ylacetate (PubChem CID 3678349) has the molecular formula C18H16N2O2
and a molecular weight of 292.34 g/mol. Its IUPAC name is benzhydryl 2-imidazol-1-ylacetate.
Molecular Properties
| Compound Name | benzhydryl 2-imidazol-1-ylacetate |
| PubChem CID | 3678349 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | benzhydryl 2-imidazol-1-ylacetate |
| SMILES | O=C(Cn1ccnc1)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O2/c21-17(13-20-12-11-19-14-20)22-18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,14,18H,13H2 |
| InChIKey | GKPDOTOQYSCFOP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzhydryl 2-imidazol-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydryl 2-imidazol-1-ylacetate?
The IUPAC name of benzhydryl 2-imidazol-1-ylacetate (CID 3678349) is benzhydryl 2-imidazol-1-ylacetate.
What is the SMILES notation for benzhydryl 2-imidazol-1-ylacetate?
The canonical SMILES for benzhydryl 2-imidazol-1-ylacetate is O=C(Cn1ccnc1)OC(c1ccccc1)c1ccccc1.
What is the InChIKey of benzhydryl 2-imidazol-1-ylacetate?
The InChIKey is GKPDOTOQYSCFOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2/c21-17(13-20-12-11-19-14-20)22-18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,14,18H,13H2.
What are the key properties of benzhydryl 2-imidazol-1-ylacetate?
benzhydryl 2-imidazol-1-ylacetate has a molecular weight of 292.34 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydryl 2-imidazol-1-ylacetate is sourced from PubChem (CID 3678349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).