About 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide
4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide (PubChem CID 3678600) has the molecular formula C15H23NO4S
and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide |
| PubChem CID | 3678600 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)N(C)CC2OCCO2)cc1 |
| InChI | InChI=1S/C15H23NO4S/c1-3-4-5-13-6-8-14(9-7-13)21(17,18)16(2)12-15-19-10-11-20-15/h6-9,15H,3-5,10-12H2,1-2H3 |
| InChIKey | WVWFRJZRFDRQQW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide?
The IUPAC name of 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide (CID 3678600) is 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide.
What is the SMILES notation for 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide?
The canonical SMILES for 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide is CCCCc1ccc(S(=O)(=O)N(C)CC2OCCO2)cc1.
What is the InChIKey of 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide?
The InChIKey is WVWFRJZRFDRQQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO4S/c1-3-4-5-13-6-8-14(9-7-13)21(17,18)16(2)12-15-19-10-11-20-15/h6-9,15H,3-5,10-12H2,1-2H3.
What are the key properties of 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide?
4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide has a molecular weight of 313.42 g/mol, XLogP of 2.02, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-N-(1,3-dioxolan-2-ylmethyl)-N-methylbenzenesulfonamide is sourced from PubChem (CID 3678600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).