About ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate
ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate (PubChem CID 3679118) has the molecular formula C21H33NO3
and a molecular weight of 347.50 g/mol. Its IUPAC name is ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate.
Molecular Properties
| Compound Name | ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate |
| PubChem CID | 3679118 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate |
| SMILES | CCOC(=O)C=C(C)NCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H33NO3/c1-9-25-18(23)10-14(2)22-13-15-11-16(20(3,4)5)19(24)17(12-15)21(6,7)8/h10-12,22,24H,9,13H2,1-8H3 |
| InChIKey | VNELFTQKRBLFCV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate?
The IUPAC name of ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate (CID 3679118) is ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate.
What is the SMILES notation for ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate?
The canonical SMILES for ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate is CCOC(=O)C=C(C)NCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate?
The InChIKey is VNELFTQKRBLFCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33NO3/c1-9-25-18(23)10-14(2)22-13-15-11-16(20(3,4)5)19(24)17(12-15)21(6,7)8/h10-12,22,24H,9,13H2,1-8H3.
What are the key properties of ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate?
ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate has a molecular weight of 347.50 g/mol, XLogP of 4.54, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylamino]but-2-enoate is sourced from PubChem (CID 3679118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).