About oxolan-2-ylmethylurea
oxolan-2-ylmethylurea (PubChem CID 3680258) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is oxolan-2-ylmethylurea.
Molecular Properties
| Compound Name | oxolan-2-ylmethylurea |
| PubChem CID | 3680258 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | oxolan-2-ylmethylurea |
| SMILES | NC(=O)NCC1CCCO1 |
| InChI | InChI=1S/C6H12N2O2/c7-6(9)8-4-5-2-1-3-10-5/h5H,1-4H2,(H3,7,8,9) |
| InChIKey | WKCQWWYEUQLEJW-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze oxolan-2-ylmethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-ylmethylurea?
The IUPAC name of oxolan-2-ylmethylurea (CID 3680258) is oxolan-2-ylmethylurea.
What is the SMILES notation for oxolan-2-ylmethylurea?
The canonical SMILES for oxolan-2-ylmethylurea is NC(=O)NCC1CCCO1.
What is the InChIKey of oxolan-2-ylmethylurea?
The InChIKey is WKCQWWYEUQLEJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c7-6(9)8-4-5-2-1-3-10-5/h5H,1-4H2,(H3,7,8,9).
What are the key properties of oxolan-2-ylmethylurea?
oxolan-2-ylmethylurea has a molecular weight of 144.17 g/mol, XLogP of -0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-ylmethylurea is sourced from PubChem (CID 3680258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).