C23H19F3N4O — CID 36804451
[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 36804451) has the molecular formula C23H19F3N4O and a molecular weight of 424.43 g/mol. Its IUPAC name is [5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | [5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 36804451 |
| Molecular Formula | C23H19F3N4O |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | [5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCc3[nH]c4ccccc4c3C2)cnn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H19F3N4O/c1-14-18(12-27-30(14)16-6-4-5-15(11-16)23(24,25)26)22(31)29-10-9-21-19(13-29)17-7-2-3-8-20(17)28-21/h2-8,11-12,28H,9-10,13H2,1H3 |
| InChIKey | YWWIYFIXOHYIBK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|