C17H12FN3O2 — CID 36805707
4-fluoro-N-(2-methyl-1,3-benzoxazol-5-yl)-1H-indole-2-carboxamide (PubChem CID 36805707) has the molecular formula C17H12FN3O2 and a molecular weight of 309.30 g/mol. Its IUPAC name is 4-fluoro-N-(2-methyl-1,3-benzoxazol-5-yl)-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-N-(2-methyl-1,3-benzoxazol-5-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 36805707 |
| Molecular Formula | C17H12FN3O2 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-fluoro-N-(2-methyl-1,3-benzoxazol-5-yl)-1H-indole-2-carboxamide |
| SMILES | Cc1nc2cc(NC(=O)c3cc4c(F)cccc4[nH]3)ccc2o1 |
| InChI | InChI=1S/C17H12FN3O2/c1-9-19-14-7-10(5-6-16(14)23-9)20-17(22)15-8-11-12(18)3-2-4-13(11)21-15/h2-8,21H,1H3,(H,20,22) |
| InChIKey | DLDGQYRBPKKPJY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |