About 3-octadecoxypropane-1,2-diol
3-octadecoxypropane-1,2-diol (PubChem CID 3681) has the molecular formula C21H44O3
and a molecular weight of 344.58 g/mol. Its IUPAC name is 3-octadecoxypropane-1,2-diol.
Molecular Properties
| Compound Name | 3-octadecoxypropane-1,2-diol |
| PubChem CID | 3681 |
| Molecular Formula | C21H44O3 |
| Molecular Weight | 344.58 g/mol |
| Exact Mass | 344.33 |
| IUPAC Name | 3-octadecoxypropane-1,2-diol |
| SMILES | CCCCCCCCCCCCCCCCCCOCC(O)CO |
| InChI | InChI=1S/C21H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-20-21(23)19-22/h21-23H,2-20H2,1H3 |
| InChIKey | OGBUMNBNEWYMNJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-octadecoxypropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octadecoxypropane-1,2-diol?
The IUPAC name of 3-octadecoxypropane-1,2-diol (CID 3681) is 3-octadecoxypropane-1,2-diol.
What is the SMILES notation for 3-octadecoxypropane-1,2-diol?
The canonical SMILES for 3-octadecoxypropane-1,2-diol is CCCCCCCCCCCCCCCCCCOCC(O)CO.
What is the InChIKey of 3-octadecoxypropane-1,2-diol?
The InChIKey is OGBUMNBNEWYMNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-20-21(23)19-22/h21-23H,2-20H2,1H3.
What are the key properties of 3-octadecoxypropane-1,2-diol?
3-octadecoxypropane-1,2-diol has a molecular weight of 344.58 g/mol, XLogP of 5.62, 20 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octadecoxypropane-1,2-diol is sourced from PubChem (CID 3681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).