C18H24N2O2S — CID 3681422
3-(2,6-dimethylphenyl)-1-[1-(furan-2-yl)ethyl]-1-(2-methoxyethyl)thiourea (PubChem CID 3681422) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-1-[1-(furan-2-yl)ethyl]-1-(2-methoxyethyl)thiourea.
| Compound Name | 3-(2,6-dimethylphenyl)-1-[1-(furan-2-yl)ethyl]-1-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 3681422 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-1-[1-(furan-2-yl)ethyl]-1-(2-methoxyethyl)thiourea |
| SMILES | COCCN(C(=S)Nc1c(C)cccc1C)C(C)c1ccco1 |
| InChI | InChI=1S/C18H24N2O2S/c1-13-7-5-8-14(2)17(13)19-18(23)20(10-12-21-4)15(3)16-9-6-11-22-16/h5-9,11,15H,10,12H2,1-4H3,(H,19,23) |
| InChIKey | CPZDOUZIIVENRN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|