About 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone
1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone (PubChem CID 3681815) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone.
Molecular Properties
| Compound Name | 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone |
| PubChem CID | 3681815 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone |
| SMILES | CC(=O)C1=C(O)CC2C1C2(C)C |
| InChI | InChI=1S/C10H14O2/c1-5(11)8-7(12)4-6-9(8)10(6,2)3/h6,9,12H,4H2,1-3H3 |
| InChIKey | FBWBTJJCGGUPJP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone?
The IUPAC name of 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone (CID 3681815) is 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone.
What is the SMILES notation for 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone?
The canonical SMILES for 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone is CC(=O)C1=C(O)CC2C1C2(C)C.
What is the InChIKey of 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone?
The InChIKey is FBWBTJJCGGUPJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-5(11)8-7(12)4-6-9(8)10(6,2)3/h6,9,12H,4H2,1-3H3.
What are the key properties of 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone?
1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone has a molecular weight of 166.22 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-hydroxy-6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)ethanone is sourced from PubChem (CID 3681815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).