C15H13FN4O5 — CID 3682241
ethyl 7-(4-fluorophenyl)-1-nitroso-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate (PubChem CID 3682241) has the molecular formula C15H13FN4O5 and a molecular weight of 348.29 g/mol. Its IUPAC name is ethyl 7-(4-fluorophenyl)-1-nitroso-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate.
| Compound Name | ethyl 7-(4-fluorophenyl)-1-nitroso-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 3682241 |
| Molecular Formula | C15H13FN4O5 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | ethyl 7-(4-fluorophenyl)-1-nitroso-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(N=O)C2(CC(=O)N(c3ccc(F)cc3)C2=O)C1 |
| InChI | InChI=1S/C15H13FN4O5/c1-2-25-13(22)11-7-15(20(17-11)18-24)8-12(21)19(14(15)23)10-5-3-9(16)4-6-10/h3-6H,2,7-8H2,1H3 |
| InChIKey | KKPLHCVXCHAZJZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 108.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|