C20H18N4O4 — CID 3682293
N-(2,4-dimethoxyphenyl)-6-methyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 3682293) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-6-methyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-6-methyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 3682293 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-6-methyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3c(=O)n4ccccc4nc3n2C)c(OC)c1 |
| InChI | InChI=1S/C20H18N4O4/c1-23-15(19(25)21-14-8-7-12(27-2)10-16(14)28-3)11-13-18(23)22-17-6-4-5-9-24(17)20(13)26/h4-11H,1-3H3,(H,21,25) |
| InChIKey | RBDABGVVFIWROV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |