C13H20N4S2 — CID 3682558
1-methyl-3-[2,4,6-trimethyl-3-(methylcarbamothioylamino)phenyl]thiourea (PubChem CID 3682558) has the molecular formula C13H20N4S2 and a molecular weight of 296.47 g/mol. Its IUPAC name is 1-methyl-3-[2,4,6-trimethyl-3-(methylcarbamothioylamino)phenyl]thiourea.
| Compound Name | 1-methyl-3-[2,4,6-trimethyl-3-(methylcarbamothioylamino)phenyl]thiourea |
|---|---|
| PubChem CID | 3682558 |
| Molecular Formula | C13H20N4S2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-methyl-3-[2,4,6-trimethyl-3-(methylcarbamothioylamino)phenyl]thiourea |
| SMILES | CNC(=S)Nc1c(C)cc(C)c(NC(=S)NC)c1C |
| InChI | InChI=1S/C13H20N4S2/c1-7-6-8(2)11(17-13(19)15-5)9(3)10(7)16-12(18)14-4/h6H,1-5H3,(H2,14,16,18)(H2,15,17,19) |
| InChIKey | WKSKZBWIOPYSAQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|