C16H22O3 — CID 3682909
3-(methoxymethyl)-6-methyl-9-methylidene-3,3a,4,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one (PubChem CID 3682909) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-(methoxymethyl)-6-methyl-9-methylidene-3,3a,4,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one.
| Compound Name | 3-(methoxymethyl)-6-methyl-9-methylidene-3,3a,4,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 3682909 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 3-(methoxymethyl)-6-methyl-9-methylidene-3,3a,4,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
| SMILES | C=C1CCC2C(C)=CCC3C(COC)C(=O)OC3C12 |
| InChI | InChI=1S/C16H22O3/c1-9-4-7-12-13(8-18-3)16(17)19-15(12)14-10(2)5-6-11(9)14/h4,11-15H,2,5-8H2,1,3H3 |
| InChIKey | DMHGHMCZSVGTLQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|