C24H24F4N4O5 — CID 3683119
1-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]-3-[4-fluoro-2-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 3683119) has the molecular formula C24H24F4N4O5 and a molecular weight of 524.47 g/mol. Its IUPAC name is 1-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]-3-[4-fluoro-2-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | 1-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]-3-[4-fluoro-2-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3683119 |
| Molecular Formula | C24H24F4N4O5 |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 1-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]-3-[4-fluoro-2-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | C=CCOc1nc(OCC=C)nc(OCC2CN(C(=O)C=Cc3ccc(F)cc3C(F)(F)F)CCO2)n1 |
| InChI | InChI=1S/C24H24F4N4O5/c1-3-10-35-21-29-22(36-11-4-2)31-23(30-21)37-15-18-14-32(9-12-34-18)20(33)8-6-16-5-7-17(25)13-19(16)24(26,27)28/h3-8,13,18H,1-2,9-12,14-15H2 |
| InChIKey | GUPKZWFCCKDEBU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 95.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|