About 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate
6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate (PubChem CID 3683302) has the molecular formula C29H36N2O4
and a molecular weight of 476.62 g/mol. Its IUPAC name is 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate.
Molecular Properties
| Compound Name | 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate |
| PubChem CID | 3683302 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate |
| SMILES | CC1CC[NH+](Cc2c([O-])c(C[NH+]3CCC(C)CC3)c3oc(-c4ccccc4)cc(=O)c3c2[O-])CC1 |
| InChI | InChI=1S/C29H36N2O4/c1-19-8-12-30(13-9-19)17-22-27(33)23(18-31-14-10-20(2)11-15-31)29-26(28(22)34)24(32)16-25(35-29)21-6-4-3-5-7-21/h3-7,16,19-20,33-34H,8-15,17-18H2,1-2H3 |
| InChIKey | MTUADUGMKAWCMU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 85.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate?
The IUPAC name of 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate (CID 3683302) is 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate.
What is the SMILES notation for 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate?
The canonical SMILES for 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate is CC1CC[NH+](Cc2c([O-])c(C[NH+]3CCC(C)CC3)c3oc(-c4ccccc4)cc(=O)c3c2[O-])CC1.
What is the InChIKey of 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate?
The InChIKey is MTUADUGMKAWCMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H36N2O4/c1-19-8-12-30(13-9-19)17-22-27(33)23(18-31-14-10-20(2)11-15-31)29-26(28(22)34)24(32)16-25(35-29)21-6-4-3-5-7-21/h3-7,16,19-20,33-34H,8-15,17-18H2,1-2H3.
What are the key properties of 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate?
6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate has a molecular weight of 476.62 g/mol, XLogP of 1.24, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-bis[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-2-phenylchromene-5,7-diolate is sourced from PubChem (CID 3683302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).