About 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one
3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 3683534) has the molecular formula C15H19NOS
and a molecular weight of 261.39 g/mol. Its IUPAC name is 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one |
| PubChem CID | 3683534 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccccc2)N1C1CCCCC1 |
| InChI | InChI=1S/C15H19NOS/c17-14-11-18-15(12-7-3-1-4-8-12)16(14)13-9-5-2-6-10-13/h1,3-4,7-8,13,15H,2,5-6,9-11H2 |
| InChIKey | OULICINYPCYJOF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one?
The IUPAC name of 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one (CID 3683534) is 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one?
The canonical SMILES for 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one is O=C1CSC(c2ccccc2)N1C1CCCCC1.
What is the InChIKey of 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one?
The InChIKey is OULICINYPCYJOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NOS/c17-14-11-18-15(12-7-3-1-4-8-12)16(14)13-9-5-2-6-10-13/h1,3-4,7-8,13,15H,2,5-6,9-11H2.
What are the key properties of 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one?
3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one has a molecular weight of 261.39 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-2-phenyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 3683534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).