C18H20ClNO4 — CID 36843513
N-(3-chloro-4-methoxyphenyl)-3-(ethoxymethyl)-4-methoxybenzamide (PubChem CID 36843513) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-3-(ethoxymethyl)-4-methoxybenzamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-3-(ethoxymethyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 36843513 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-3-(ethoxymethyl)-4-methoxybenzamide |
| SMILES | CCOCc1cc(C(=O)Nc2ccc(OC)c(Cl)c2)ccc1OC |
| InChI | InChI=1S/C18H20ClNO4/c1-4-24-11-13-9-12(5-7-16(13)22-2)18(21)20-14-6-8-17(23-3)15(19)10-14/h5-10H,4,11H2,1-3H3,(H,20,21) |
| InChIKey | KSZKASVOERIFPC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |