C20H24FN3O — CID 36846051
N-(3-ethylphenyl)-2-[4-(2-fluorophenyl)piperazin-1-yl]acetamide (PubChem CID 36846051) has the molecular formula C20H24FN3O and a molecular weight of 341.43 g/mol. Its IUPAC name is N-(3-ethylphenyl)-2-[4-(2-fluorophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-(3-ethylphenyl)-2-[4-(2-fluorophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 36846051 |
| Molecular Formula | C20H24FN3O |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-(3-ethylphenyl)-2-[4-(2-fluorophenyl)piperazin-1-yl]acetamide |
| SMILES | CCc1cccc(NC(=O)CN2CCN(c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C20H24FN3O/c1-2-16-6-5-7-17(14-16)22-20(25)15-23-10-12-24(13-11-23)19-9-4-3-8-18(19)21/h3-9,14H,2,10-13,15H2,1H3,(H,22,25) |
| InChIKey | XDNNKGVAHGFQIG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |