C18H26N4O4S — CID 3685132
N-(2,8-dioxo-5-prop-2-enoxy-1,7-diazatricyclo[7.4.0.03,7]tridecan-11-yl)-1,3-thiazolidine-4-carboxamide (PubChem CID 3685132) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-(2,8-dioxo-5-prop-2-enoxy-1,7-diazatricyclo[7.4.0.03,7]tridecan-11-yl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2,8-dioxo-5-prop-2-enoxy-1,7-diazatricyclo[7.4.0.03,7]tridecan-11-yl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 3685132 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-(2,8-dioxo-5-prop-2-enoxy-1,7-diazatricyclo[7.4.0.03,7]tridecan-11-yl)-1,3-thiazolidine-4-carboxamide |
| SMILES | C=CCOC1CC2C(=O)N3CCC(NC(=O)C4CSCN4)CC3C(=O)N2C1 |
| InChI | InChI=1S/C18H26N4O4S/c1-2-5-26-12-7-15-17(24)21-4-3-11(6-14(21)18(25)22(15)8-12)20-16(23)13-9-27-10-19-13/h2,11-15,19H,1,3-10H2,(H,20,23) |
| InChIKey | AJUVRWFPFALYCM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|