About 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde
4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde (PubChem CID 3685686) has the molecular formula C5H8N2O4
and a molecular weight of 160.13 g/mol. Its IUPAC name is 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde.
Molecular Properties
| Compound Name | 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde |
| PubChem CID | 3685686 |
| Molecular Formula | C5H8N2O4 |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde |
| SMILES | O=CN1CN(C=O)C(O)C1O |
| InChI | InChI=1S/C5H8N2O4/c8-2-6-1-7(3-9)5(11)4(6)10/h2-5,10-11H,1H2 |
| InChIKey | QEXYKFIUOZNZLW-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde?
The IUPAC name of 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde (CID 3685686) is 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde.
What is the SMILES notation for 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde?
The canonical SMILES for 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde is O=CN1CN(C=O)C(O)C1O.
What is the InChIKey of 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde?
The InChIKey is QEXYKFIUOZNZLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O4/c8-2-6-1-7(3-9)5(11)4(6)10/h2-5,10-11H,1H2.
What are the key properties of 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde?
4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde has a molecular weight of 160.13 g/mol, XLogP of -2.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxyimidazolidine-1,3-dicarbaldehyde is sourced from PubChem (CID 3685686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).