C20H29N5O6 — CID 3685869
ethyl 2-[[2-oxo-2-[4-(2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl)piperidin-1-yl]-1-(1H-pyrazol-5-yl)ethylidene]amino]oxyacetate (PubChem CID 3685869) has the molecular formula C20H29N5O6 and a molecular weight of 435.48 g/mol. Its IUPAC name is ethyl 2-[[2-oxo-2-[4-(2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl)piperidin-1-yl]-1-(1H-pyrazol-5-yl)ethylidene]amino]oxyacetate.
| Compound Name | ethyl 2-[[2-oxo-2-[4-(2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl)piperidin-1-yl]-1-(1H-pyrazol-5-yl)ethylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 3685869 |
| Molecular Formula | C20H29N5O6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | ethyl 2-[[2-oxo-2-[4-(2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl)piperidin-1-yl]-1-(1H-pyrazol-5-yl)ethylidene]amino]oxyacetate |
| SMILES | CCOC(=O)CON=C(C(=O)N1CCC(N2C(=O)OCC2C(C)C)CC1)c1ccn[nH]1 |
| InChI | InChI=1S/C20H29N5O6/c1-4-29-17(26)12-31-23-18(15-5-8-21-22-15)19(27)24-9-6-14(7-10-24)25-16(13(2)3)11-30-20(25)28/h5,8,13-14,16H,4,6-7,9-12H2,1-3H3,(H,21,22) |
| InChIKey | UXDIVUWEWXNNET-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 126.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|