C18H15N2O3- — CID 3687425
4-[(6-methoxy-2-methylquinolin-4-yl)amino]benzoate (PubChem CID 3687425) has the molecular formula C18H15N2O3- and a molecular weight of 307.33 g/mol. Its IUPAC name is 4-[(6-methoxy-2-methylquinolin-4-yl)amino]benzoate.
| Compound Name | 4-[(6-methoxy-2-methylquinolin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 3687425 |
| Molecular Formula | C18H15N2O3- |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-[(6-methoxy-2-methylquinolin-4-yl)amino]benzoate |
| SMILES | COc1ccc2nc(C)cc(Nc3ccc(C(=O)[O-])cc3)c2c1 |
| InChI | InChI=1S/C18H16N2O3/c1-11-9-17(15-10-14(23-2)7-8-16(15)19-11)20-13-5-3-12(4-6-13)18(21)22/h3-10H,1-2H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | KZDORVYRVHBBOW-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |