About 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one
3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 3687480) has the molecular formula C18H18N2O
and a molecular weight of 278.36 g/mol. Its IUPAC name is 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one |
| PubChem CID | 3687480 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | Cc1ccc(C2=NNC(=O)C(c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C18H18N2O/c1-12-3-7-14(8-4-12)16-11-17(19-20-18(16)21)15-9-5-13(2)6-10-15/h3-10,16H,11H2,1-2H3,(H,20,21) |
| InChIKey | HTHJSQRGCASRSN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one?
The IUPAC name of 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one (CID 3687480) is 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one.
What is the SMILES notation for 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one?
The canonical SMILES for 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one is Cc1ccc(C2=NNC(=O)C(c3ccc(C)cc3)C2)cc1.
What is the InChIKey of 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one?
The InChIKey is HTHJSQRGCASRSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O/c1-12-3-7-14(8-4-12)16-11-17(19-20-18(16)21)15-9-5-13(2)6-10-15/h3-10,16H,11H2,1-2H3,(H,20,21).
What are the key properties of 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one?
3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one has a molecular weight of 278.36 g/mol, XLogP of 3.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(4-methylphenyl)-4,5-dihydro-1H-pyridazin-6-one is sourced from PubChem (CID 3687480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).