C19H22BrN2O+ — CID 3687545
2-[6-(3-bromophenyl)-2-propyl-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol (PubChem CID 3687545) has the molecular formula C19H22BrN2O+ and a molecular weight of 374.30 g/mol. Its IUPAC name is 2-[6-(3-bromophenyl)-2-propyl-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol.
| Compound Name | 2-[6-(3-bromophenyl)-2-propyl-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol |
|---|---|
| PubChem CID | 3687545 |
| Molecular Formula | C19H22BrN2O+ |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-[6-(3-bromophenyl)-2-propyl-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol |
| SMILES | CCCC1NC(c2cccc(Br)c2)=CC(c2ccccc2O)[NH2+]1 |
| InChI | InChI=1S/C19H21BrN2O/c1-2-6-19-21-16(13-7-5-8-14(20)11-13)12-17(22-19)15-9-3-4-10-18(15)23/h3-5,7-12,17,19,21-23H,2,6H2,1H3/p+1 |
| InChIKey | BTRQUAZPCINIQM-UHFFFAOYSA-O |
| XLogP | 3.53 |
| TPSA | 48.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|