C19H21FN4O4 — CID 36875873
2-[4-(4-fluorobenzoyl)piperazin-1-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide (PubChem CID 36875873) has the molecular formula C19H21FN4O4 and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-[4-(4-fluorobenzoyl)piperazin-1-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[4-(4-fluorobenzoyl)piperazin-1-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 36875873 |
| Molecular Formula | C19H21FN4O4 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-[4-(4-fluorobenzoyl)piperazin-1-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2ccc(F)cc2)CC1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C19H21FN4O4/c20-15-5-3-14(4-6-15)18(26)24-9-7-23(8-10-24)13-17(25)22-19(27)21-12-16-2-1-11-28-16/h1-6,11H,7-10,12-13H2,(H2,21,22,25,27) |
| InChIKey | FBRWWDCMPFUUIB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |