About [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone
[4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 36877918) has the molecular formula C16H19FN4O2
and a molecular weight of 318.35 g/mol. Its IUPAC name is [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone |
| PubChem CID | 36877918 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | CCc1nnc(CN2CCN(C(=O)c3ccc(F)cc3)CC2)o1 |
| InChI | InChI=1S/C16H19FN4O2/c1-2-14-18-19-15(23-14)11-20-7-9-21(10-8-20)16(22)12-3-5-13(17)6-4-12/h3-6H,2,7-11H2,1H3 |
| InChIKey | SMEAWSMZZQZFIC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone?
The IUPAC name of [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone (CID 36877918) is [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone.
What is the SMILES notation for [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone?
The canonical SMILES for [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone is CCc1nnc(CN2CCN(C(=O)c3ccc(F)cc3)CC2)o1.
What is the InChIKey of [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone?
The InChIKey is SMEAWSMZZQZFIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19FN4O2/c1-2-14-18-19-15(23-14)11-20-7-9-21(10-8-20)16(22)12-3-5-13(17)6-4-12/h3-6H,2,7-11H2,1H3.
What are the key properties of [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone?
[4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone has a molecular weight of 318.35 g/mol, XLogP of 1.73, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]-(4-fluorophenyl)methanone is sourced from PubChem (CID 36877918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).