C19H28N6O2S — CID 3687797
1-cyclohexyl-3-[(1,3-dimethyl-4-propan-2-ylsulfanylpyrazolo[3,4-b]pyridine-5-carbonyl)amino]urea (PubChem CID 3687797) has the molecular formula C19H28N6O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1,3-dimethyl-4-propan-2-ylsulfanylpyrazolo[3,4-b]pyridine-5-carbonyl)amino]urea.
| Compound Name | 1-cyclohexyl-3-[(1,3-dimethyl-4-propan-2-ylsulfanylpyrazolo[3,4-b]pyridine-5-carbonyl)amino]urea |
|---|---|
| PubChem CID | 3687797 |
| Molecular Formula | C19H28N6O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-cyclohexyl-3-[(1,3-dimethyl-4-propan-2-ylsulfanylpyrazolo[3,4-b]pyridine-5-carbonyl)amino]urea |
| SMILES | Cc1nn(C)c2ncc(C(=O)NNC(=O)NC3CCCCC3)c(SC(C)C)c12 |
| InChI | InChI=1S/C19H28N6O2S/c1-11(2)28-16-14(10-20-17-15(16)12(3)24-25(17)4)18(26)22-23-19(27)21-13-8-6-5-7-9-13/h10-11,13H,5-9H2,1-4H3,(H,22,26)(H2,21,23,27) |
| InChIKey | RLDHJWFZTPXFMC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|