C16H12BrClN4OS2 — CID 3688374
(5-bromothiophen-2-yl)-[6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone (PubChem CID 3688374) has the molecular formula C16H12BrClN4OS2 and a molecular weight of 455.79 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)-[6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone.
| Compound Name | (5-bromothiophen-2-yl)-[6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
|---|---|
| PubChem CID | 3688374 |
| Molecular Formula | C16H12BrClN4OS2 |
| Molecular Weight | 455.79 g/mol |
| Exact Mass | 453.93 |
| IUPAC Name | (5-bromothiophen-2-yl)-[6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
| SMILES | Cc1nnc2n1NC(c1ccc(Cl)cc1)C(C(=O)c1ccc(Br)s1)S2 |
| InChI | InChI=1S/C16H12BrClN4OS2/c1-8-19-20-16-22(8)21-13(9-2-4-10(18)5-3-9)15(25-16)14(23)11-6-7-12(17)24-11/h2-7,13,15,21H,1H3 |
| InChIKey | ZMDZOXPOPUKTDL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.79 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |