C20H25N3O2 — CID 3688554
4-(2,6-dimethylphenyl)-N-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 3688554) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)-N-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(2,6-dimethylphenyl)-N-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3688554 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 4-(2,6-dimethylphenyl)-N-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(c3c(C)cccc3C)CC2)cc1 |
| InChI | InChI=1S/C20H25N3O2/c1-15-5-4-6-16(2)19(15)22-11-13-23(14-12-22)20(24)21-17-7-9-18(25-3)10-8-17/h4-10H,11-14H2,1-3H3,(H,21,24) |
| InChIKey | LNUPFIHDGLBISX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |