About [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol
[5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol (PubChem CID 3688613) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol |
| PubChem CID | 3688613 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol |
| SMILES | OCC1OC(c2ccccc2)OC1CO |
| InChI | InChI=1S/C11H14O4/c12-6-9-10(7-13)15-11(14-9)8-4-2-1-3-5-8/h1-5,9-13H,6-7H2 |
| InChIKey | AEJRVTSEJAYBNR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol (CID 3688613) is [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol is OCC1OC(c2ccccc2)OC1CO.
What is the InChIKey of [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol?
The InChIKey is AEJRVTSEJAYBNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c12-6-9-10(7-13)15-11(14-9)8-4-2-1-3-5-8/h1-5,9-13H,6-7H2.
What are the key properties of [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol?
[5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol has a molecular weight of 210.23 g/mol, XLogP of 0.45, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-2-phenyl-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 3688613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).