C22H28N4O5S — CID 36892865
[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]carbamoylamino]-2-oxoethyl] 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate (PubChem CID 36892865) has the molecular formula C22H28N4O5S and a molecular weight of 460.56 g/mol. Its IUPAC name is [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]carbamoylamino]-2-oxoethyl] 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate.
| Compound Name | [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]carbamoylamino]-2-oxoethyl] 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 36892865 |
| Molecular Formula | C22H28N4O5S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]carbamoylamino]-2-oxoethyl] 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate |
| SMILES | Cc1noc(CSc2ccccc2C(=O)OCC(=O)NC(=O)N[C@@H]2CCC[C@@H](C)[C@H]2C)n1 |
| InChI | InChI=1S/C22H28N4O5S/c1-13-7-6-9-17(14(13)2)24-22(29)25-19(27)11-30-21(28)16-8-4-5-10-18(16)32-12-20-23-15(3)26-31-20/h4-5,8,10,13-14,17H,6-7,9,11-12H2,1-3H3,(H2,24,25,27,29)/t13-,14-,17-/m1/s1 |
| InChIKey | CZHNZFAQFXHIGR-CKEIUWERSA-N |
| XLogP | 3.48 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |