C20H20N4O4S — CID 36897572
N'-(4-ethoxybenzoyl)-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]benzohydrazide (PubChem CID 36897572) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is N'-(4-ethoxybenzoyl)-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]benzohydrazide.
| Compound Name | N'-(4-ethoxybenzoyl)-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]benzohydrazide |
|---|---|
| PubChem CID | 36897572 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N'-(4-ethoxybenzoyl)-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]benzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2ccccc2SCc2noc(C)n2)cc1 |
| InChI | InChI=1S/C20H20N4O4S/c1-3-27-15-10-8-14(9-11-15)19(25)22-23-20(26)16-6-4-5-7-17(16)29-12-18-21-13(2)28-24-18/h4-11H,3,12H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | CDCUQNIDPMICHT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|