C16H29N3O3S — CID 3690578
(4-methylpiperidin-1-yl)-(1-pyrrolidin-1-ylsulfonylpiperidin-4-yl)methanone (PubChem CID 3690578) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-(1-pyrrolidin-1-ylsulfonylpiperidin-4-yl)methanone.
| Compound Name | (4-methylpiperidin-1-yl)-(1-pyrrolidin-1-ylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 3690578 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (4-methylpiperidin-1-yl)-(1-pyrrolidin-1-ylsulfonylpiperidin-4-yl)methanone |
| SMILES | CC1CCN(C(=O)C2CCN(S(=O)(=O)N3CCCC3)CC2)CC1 |
| InChI | InChI=1S/C16H29N3O3S/c1-14-4-10-17(11-5-14)16(20)15-6-12-19(13-7-15)23(21,22)18-8-2-3-9-18/h14-15H,2-13H2,1H3 |
| InChIKey | IKAMYYCARRONHL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |