C24H34N2O4S — CID 3690697
7-(benzenesulfonamido)-N-[2-(4-propylphenoxy)ethyl]heptanamide (PubChem CID 3690697) has the molecular formula C24H34N2O4S and a molecular weight of 446.61 g/mol. Its IUPAC name is 7-(benzenesulfonamido)-N-[2-(4-propylphenoxy)ethyl]heptanamide.
| Compound Name | 7-(benzenesulfonamido)-N-[2-(4-propylphenoxy)ethyl]heptanamide |
|---|---|
| PubChem CID | 3690697 |
| Molecular Formula | C24H34N2O4S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 7-(benzenesulfonamido)-N-[2-(4-propylphenoxy)ethyl]heptanamide |
| SMILES | CCCc1ccc(OCCNC(=O)CCCCCCNS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H34N2O4S/c1-2-10-21-14-16-22(17-15-21)30-20-19-25-24(27)13-8-3-4-9-18-26-31(28,29)23-11-6-5-7-12-23/h5-7,11-12,14-17,26H,2-4,8-10,13,18-20H2,1H3,(H,25,27) |
| InChIKey | USZDLMYLMKIRKW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|