About Zipeprol
Zipeprol (PubChem CID 36910) has the molecular formula C23H32N2O3
and a molecular weight of 384.50 g/mol. Its IUPAC name is 1-methoxy-3-[4-(2-methoxy-2-phenylethyl)piperazin-1-yl]-1-phenylpropan-2-ol.
Molecular Properties
| Compound Name | Zipeprol |
| PubChem CID | 36910 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 1-methoxy-3-[4-(2-methoxy-2-phenylethyl)piperazin-1-yl]-1-phenylpropan-2-ol |
| SMILES | COC(CN1CCN(CC1)CC(C(C2=CC=CC=C2)OC)O)C3=CC=CC=C3 |
| InChI | InChI=1S/C23H32N2O3/c1-27-22(19-9-5-3-6-10-19)18-25-15-13-24(14-16-25)17-21(26)23(28-2)20-11-7-4-8-12-20/h3-12,21-23,26H,13-18H2,1-2H3 |
| InChIKey | VSTNNAYSCJQCQI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 45.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | 416 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Zipeprol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Zipeprol?
The IUPAC name of Zipeprol (CID 36910) is 1-methoxy-3-[4-(2-methoxy-2-phenylethyl)piperazin-1-yl]-1-phenylpropan-2-ol.
What is the SMILES notation for Zipeprol?
The canonical SMILES for Zipeprol is COC(CN1CCN(CC1)CC(C(C2=CC=CC=C2)OC)O)C3=CC=CC=C3.
What is the InChIKey of Zipeprol?
The InChIKey is VSTNNAYSCJQCQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N2O3/c1-27-22(19-9-5-3-6-10-19)18-25-15-13-24(14-16-25)17-21(26)23(28-2)20-11-7-4-8-12-20/h3-12,21-23,26H,13-18H2,1-2H3.
What are the key properties of Zipeprol?
Zipeprol has a molecular weight of 384.50 g/mol, XLogP of 2.20, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Zipeprol is sourced from PubChem (CID 36910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).