About 2-methyl-1,3-dithiane-2-carbaldehyde
2-methyl-1,3-dithiane-2-carbaldehyde (PubChem CID 3691209) has the molecular formula C6H10OS2
and a molecular weight of 162.28 g/mol. Its IUPAC name is 2-methyl-1,3-dithiane-2-carbaldehyde.
Molecular Properties
| Compound Name | 2-methyl-1,3-dithiane-2-carbaldehyde |
| PubChem CID | 3691209 |
| Molecular Formula | C6H10OS2 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | 2-methyl-1,3-dithiane-2-carbaldehyde |
| SMILES | CC1(C=O)SCCCS1 |
| InChI | InChI=1S/C6H10OS2/c1-6(5-7)8-3-2-4-9-6/h5H,2-4H2,1H3 |
| InChIKey | MPTGKIPTVOWUDD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,3-dithiane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-dithiane-2-carbaldehyde?
The IUPAC name of 2-methyl-1,3-dithiane-2-carbaldehyde (CID 3691209) is 2-methyl-1,3-dithiane-2-carbaldehyde.
What is the SMILES notation for 2-methyl-1,3-dithiane-2-carbaldehyde?
The canonical SMILES for 2-methyl-1,3-dithiane-2-carbaldehyde is CC1(C=O)SCCCS1.
What is the InChIKey of 2-methyl-1,3-dithiane-2-carbaldehyde?
The InChIKey is MPTGKIPTVOWUDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS2/c1-6(5-7)8-3-2-4-9-6/h5H,2-4H2,1H3.
What are the key properties of 2-methyl-1,3-dithiane-2-carbaldehyde?
2-methyl-1,3-dithiane-2-carbaldehyde has a molecular weight of 162.28 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-dithiane-2-carbaldehyde is sourced from PubChem (CID 3691209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).