About 2-bromo-1,3-bis(3-methylphenyl)benzene
2-bromo-1,3-bis(3-methylphenyl)benzene (PubChem CID 3691341) has the molecular formula C20H17Br
and a molecular weight of 337.26 g/mol. Its IUPAC name is 2-bromo-1,3-bis(3-methylphenyl)benzene.
Molecular Properties
| Compound Name | 2-bromo-1,3-bis(3-methylphenyl)benzene |
| PubChem CID | 3691341 |
| Molecular Formula | C20H17Br |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-bromo-1,3-bis(3-methylphenyl)benzene |
| SMILES | Cc1cccc(-c2cccc(-c3cccc(C)c3)c2Br)c1 |
| InChI | InChI=1S/C20H17Br/c1-14-6-3-8-16(12-14)18-10-5-11-19(20(18)21)17-9-4-7-15(2)13-17/h3-13H,1-2H3 |
| InChIKey | JFGFYZCDCMTWBJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-bromo-1,3-bis(3-methylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3-bis(3-methylphenyl)benzene?
The IUPAC name of 2-bromo-1,3-bis(3-methylphenyl)benzene (CID 3691341) is 2-bromo-1,3-bis(3-methylphenyl)benzene.
What is the SMILES notation for 2-bromo-1,3-bis(3-methylphenyl)benzene?
The canonical SMILES for 2-bromo-1,3-bis(3-methylphenyl)benzene is Cc1cccc(-c2cccc(-c3cccc(C)c3)c2Br)c1.
What is the InChIKey of 2-bromo-1,3-bis(3-methylphenyl)benzene?
The InChIKey is JFGFYZCDCMTWBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17Br/c1-14-6-3-8-16(12-14)18-10-5-11-19(20(18)21)17-9-4-7-15(2)13-17/h3-13H,1-2H3.
What are the key properties of 2-bromo-1,3-bis(3-methylphenyl)benzene?
2-bromo-1,3-bis(3-methylphenyl)benzene has a molecular weight of 337.26 g/mol, XLogP of 6.40, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3-bis(3-methylphenyl)benzene is sourced from PubChem (CID 3691341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).