About 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide
2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 3691378) has the molecular formula C22H26N4O2S
and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide |
| PubChem CID | 3691378 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CSc1nc2cccnc2n1C1CCCCC1 |
| InChI | InChI=1S/C22H26N4O2S/c1-15-10-11-19(28-2)18(13-15)24-20(27)14-29-22-25-17-9-6-12-23-21(17)26(22)16-7-4-3-5-8-16/h6,9-13,16H,3-5,7-8,14H2,1-2H3,(H,24,27) |
| InChIKey | MLCPHXCXBAZJPC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide?
The IUPAC name of 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide (CID 3691378) is 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide.
What is the SMILES notation for 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide?
The canonical SMILES for 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide is COc1ccc(C)cc1NC(=O)CSc1nc2cccnc2n1C1CCCCC1.
What is the InChIKey of 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide?
The InChIKey is MLCPHXCXBAZJPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O2S/c1-15-10-11-19(28-2)18(13-15)24-20(27)14-29-22-25-17-9-6-12-23-21(17)26(22)16-7-4-3-5-8-16/h6,9-13,16H,3-5,7-8,14H2,1-2H3,(H,24,27).
What are the key properties of 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide?
2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide has a molecular weight of 410.54 g/mol, XLogP of 4.98, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)sulfanyl-N-(2-methoxy-5-methylphenyl)acetamide is sourced from PubChem (CID 3691378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).