C21H32N4OS — CID 36922439
N-(7-methyloctyl)-3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide (PubChem CID 36922439) has the molecular formula C21H32N4OS and a molecular weight of 388.58 g/mol. Its IUPAC name is N-(7-methyloctyl)-3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide.
| Compound Name | N-(7-methyloctyl)-3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 36922439 |
| Molecular Formula | C21H32N4OS |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-(7-methyloctyl)-3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CCC(=O)NCCCCCCC(C)C)c1 |
| InChI | InChI=1S/C21H32N4OS/c1-16(2)9-6-4-5-7-13-22-19(26)12-14-25-20(23-24-21(25)27)18-11-8-10-17(3)15-18/h8,10-11,15-16H,4-7,9,12-14H2,1-3H3,(H,22,26)(H,24,27) |
| InChIKey | GNZVJWNPNDVGID-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|