C27H24N4O7 — CID 3692286
10-(4-hydroxy-3,5-dimethoxyphenyl)-16-(4-nitroanilino)-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-12-one (PubChem CID 3692286) has the molecular formula C27H24N4O7 and a molecular weight of 516.51 g/mol. Its IUPAC name is 10-(4-hydroxy-3,5-dimethoxyphenyl)-16-(4-nitroanilino)-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-12-one.
| Compound Name | 10-(4-hydroxy-3,5-dimethoxyphenyl)-16-(4-nitroanilino)-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-12-one |
|---|---|
| PubChem CID | 3692286 |
| Molecular Formula | C27H24N4O7 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 10-(4-hydroxy-3,5-dimethoxyphenyl)-16-(4-nitroanilino)-13-oxa-8,11-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-12-one |
| SMILES | COc1cc(C2c3[nH]c4ccccc4c3C(Nc3ccc([N+](=O)[O-])cc3)C3COC(=O)N23)cc(OC)c1O |
| InChI | InChI=1S/C27H24N4O7/c1-36-20-11-14(12-21(37-2)26(20)32)25-24-22(17-5-3-4-6-18(17)29-24)23(19-13-38-27(33)30(19)25)28-15-7-9-16(10-8-15)31(34)35/h3-12,19,23,25,28-29,32H,13H2,1-2H3 |
| InChIKey | MZISFSFXJZIGGY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|