C15H24N4O — CID 3692683
4-(1-ethylpiperidin-4-yl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepin-2-one (PubChem CID 3692683) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-(1-ethylpiperidin-4-yl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepin-2-one.
| Compound Name | 4-(1-ethylpiperidin-4-yl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepin-2-one |
|---|---|
| PubChem CID | 3692683 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-(1-ethylpiperidin-4-yl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepin-2-one |
| SMILES | CCN1CCC(c2[nH]c(=O)nc3c2CCCCN3)CC1 |
| InChI | InChI=1S/C15H24N4O/c1-2-19-9-6-11(7-10-19)13-12-5-3-4-8-16-14(12)18-15(20)17-13/h11H,2-10H2,1H3,(H2,16,17,18,20) |
| InChIKey | LYFUDKOTZJZFBQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |