C26H25N5O — CID 3692693
N-(furan-2-ylmethyl)-N-methyl-2,4,6-triphenyl-1,3-dihydro-1,2,4,5-tetrazin-3-amine (PubChem CID 3692693) has the molecular formula C26H25N5O and a molecular weight of 423.52 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-methyl-2,4,6-triphenyl-1,3-dihydro-1,2,4,5-tetrazin-3-amine.
| Compound Name | N-(furan-2-ylmethyl)-N-methyl-2,4,6-triphenyl-1,3-dihydro-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 3692693 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-methyl-2,4,6-triphenyl-1,3-dihydro-1,2,4,5-tetrazin-3-amine |
| SMILES | CN(Cc1ccco1)C1N(c2ccccc2)N=C(c2ccccc2)NN1c1ccccc1 |
| InChI | InChI=1S/C26H25N5O/c1-29(20-24-18-11-19-32-24)26-30(22-14-7-3-8-15-22)27-25(21-12-5-2-6-13-21)28-31(26)23-16-9-4-10-17-23/h2-19,26H,20H2,1H3,(H,27,28) |
| InChIKey | GONGXGBQNGPUOM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 47.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |