About 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine
1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine (PubChem CID 36935980) has the molecular formula C16H17FN4O
and a molecular weight of 300.34 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine.
Molecular Properties
| Compound Name | 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine |
| PubChem CID | 36935980 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine |
| SMILES | CN(Cc1cnn(C)c1)Cc1cc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C16H17FN4O/c1-20(9-12-8-18-21(2)10-12)11-15-7-16(19-22-15)13-3-5-14(17)6-4-13/h3-8,10H,9,11H2,1-2H3 |
| InChIKey | BRUGUZORFWLNIT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine?
The IUPAC name of 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine (CID 36935980) is 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine.
What is the SMILES notation for 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine?
The canonical SMILES for 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine is CN(Cc1cnn(C)c1)Cc1cc(-c2ccc(F)cc2)no1.
What is the InChIKey of 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine?
The InChIKey is BRUGUZORFWLNIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN4O/c1-20(9-12-8-18-21(2)10-12)11-15-7-16(19-22-15)13-3-5-14(17)6-4-13/h3-8,10H,9,11H2,1-2H3.
What are the key properties of 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine?
1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine has a molecular weight of 300.34 g/mol, XLogP of 2.85, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]methanamine is sourced from PubChem (CID 36935980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).