C15H18I3NO4 — CID 3694168
ethyl 2-[2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoylamino]acetate (PubChem CID 3694168) has the molecular formula C15H18I3NO4 and a molecular weight of 657.02 g/mol. Its IUPAC name is ethyl 2-[2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoylamino]acetate.
| Compound Name | ethyl 2-[2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoylamino]acetate |
|---|---|
| PubChem CID | 3694168 |
| Molecular Formula | C15H18I3NO4 |
| Molecular Weight | 657.02 g/mol |
| Exact Mass | 656.84 |
| IUPAC Name | ethyl 2-[2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)C(CC)Cc1c(I)cc(I)c(O)c1I |
| InChI | InChI=1S/C15H18I3NO4/c1-3-8(15(22)19-7-12(20)23-4-2)5-9-10(16)6-11(17)14(21)13(9)18/h6,8,21H,3-5,7H2,1-2H3,(H,19,22) |
| InChIKey | ZUKBNPXZUBKXCY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.02 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|